C11H16BrClN2O2S2 — CID 113498483
4-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-1,2,6-trimethylpiperazine (PubChem CID 113498483) has the molecular formula C11H16BrClN2O2S2 and a molecular weight of 387.75 g/mol. Its IUPAC name is 4-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-1,2,6-trimethylpiperazine.
| Compound Name | 4-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-1,2,6-trimethylpiperazine |
|---|---|
| PubChem CID | 113498483 |
| Molecular Formula | C11H16BrClN2O2S2 |
| Molecular Weight | 387.75 g/mol |
| Exact Mass | 385.95 |
| IUPAC Name | 4-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-1,2,6-trimethylpiperazine |
| SMILES | CC1CN(S(=O)(=O)c2cc(Cl)c(Br)s2)CC(C)N1C |
| InChI | InChI=1S/C11H16BrClN2O2S2/c1-7-5-15(6-8(2)14(7)3)19(16,17)10-4-9(13)11(12)18-10/h4,7-8H,5-6H2,1-3H3 |
| InChIKey | UGZVRGJAYXMQPM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.75 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |