C10H11BrClNO2S2 — CID 115767025
1-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-4-methyl-3,6-dihydro-2H-pyridine (PubChem CID 115767025) has the molecular formula C10H11BrClNO2S2 and a molecular weight of 356.69 g/mol. Its IUPAC name is 1-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-4-methyl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-4-methyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 115767025 |
| Molecular Formula | C10H11BrClNO2S2 |
| Molecular Weight | 356.69 g/mol |
| Exact Mass | 354.91 |
| IUPAC Name | 1-(5-bromo-4-chlorothiophen-2-yl)sulfonyl-4-methyl-3,6-dihydro-2H-pyridine |
| SMILES | CC1=CCN(S(=O)(=O)c2cc(Cl)c(Br)s2)CC1 |
| InChI | InChI=1S/C10H11BrClNO2S2/c1-7-2-4-13(5-3-7)17(14,15)9-6-8(12)10(11)16-9/h2,6H,3-5H2,1H3 |
| InChIKey | MHAHADBIPXQOCW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.69 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|