C12H14BrNO2S — CID 115767029
1-(4-bromophenyl)sulfonyl-4-methyl-3,6-dihydro-2H-pyridine (PubChem CID 115767029) has the molecular formula C12H14BrNO2S and a molecular weight of 316.22 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-4-methyl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(4-bromophenyl)sulfonyl-4-methyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 115767029 |
| Molecular Formula | C12H14BrNO2S |
| Molecular Weight | 316.22 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-4-methyl-3,6-dihydro-2H-pyridine |
| SMILES | CC1=CCN(S(=O)(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C12H14BrNO2S/c1-10-6-8-14(9-7-10)17(15,16)12-4-2-11(13)3-5-12/h2-6H,7-9H2,1H3 |
| InChIKey | OOMWLONEFOLYLH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|