C14H19NO2S — CID 67224813
4-methyl-1-(4-methylphenyl)sulfonyl-2,3,6,7-tetrahydroazepine (PubChem CID 67224813) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is 4-methyl-1-(4-methylphenyl)sulfonyl-2,3,6,7-tetrahydroazepine.
| Compound Name | 4-methyl-1-(4-methylphenyl)sulfonyl-2,3,6,7-tetrahydroazepine |
|---|---|
| PubChem CID | 67224813 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 4-methyl-1-(4-methylphenyl)sulfonyl-2,3,6,7-tetrahydroazepine |
| SMILES | CC1=CCCN(S(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C14H19NO2S/c1-12-4-3-10-15(11-9-12)18(16,17)14-7-5-13(2)6-8-14/h4-8H,3,9-11H2,1-2H3 |
| InChIKey | MGIHWOFRXDPUBD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|