C30H40N4O6S3 — CID 12035988
1-methyl-4,7,10-tris-(4-methylphenyl)sulfonyl-1,4,7,10-tetrazacyclododecane (PubChem CID 12035988) has the molecular formula C30H40N4O6S3 and a molecular weight of 648.87 g/mol. Its IUPAC name is 1-methyl-4,7,10-tris-(4-methylphenyl)sulfonyl-1,4,7,10-tetrazacyclododecane.
| Compound Name | 1-methyl-4,7,10-tris-(4-methylphenyl)sulfonyl-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 12035988 |
| Molecular Formula | C30H40N4O6S3 |
| Molecular Weight | 648.87 g/mol |
| Exact Mass | 648.21 |
| IUPAC Name | 1-methyl-4,7,10-tris-(4-methylphenyl)sulfonyl-1,4,7,10-tetrazacyclododecane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C)CCN(S(=O)(=O)c3ccc(C)cc3)CCN(S(=O)(=O)c3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C30H40N4O6S3/c1-25-5-11-28(12-6-25)41(35,36)32-19-17-31(4)18-20-33(42(37,38)29-13-7-26(2)8-14-29)22-24-34(23-21-32)43(39,40)30-15-9-27(3)10-16-30/h5-16H,17-24H2,1-4H3 |
| InChIKey | YWGNXUSBTLDOMD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 115.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.87 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |