C22H30N2O6S2 — CID 1101145
4,10-bis-(4-methylphenyl)sulfonyl-1,7-dioxa-4,10-diazacyclododecane (PubChem CID 1101145) has the molecular formula C22H30N2O6S2 and a molecular weight of 482.62 g/mol. Its IUPAC name is 4,10-bis-(4-methylphenyl)sulfonyl-1,7-dioxa-4,10-diazacyclododecane.
| Compound Name | 4,10-bis-(4-methylphenyl)sulfonyl-1,7-dioxa-4,10-diazacyclododecane |
|---|---|
| PubChem CID | 1101145 |
| Molecular Formula | C22H30N2O6S2 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 4,10-bis-(4-methylphenyl)sulfonyl-1,7-dioxa-4,10-diazacyclododecane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCCN(S(=O)(=O)c3ccc(C)cc3)CCOCC2)cc1 |
| InChI | InChI=1S/C22H30N2O6S2/c1-19-3-7-21(8-4-19)31(25,26)23-11-15-29-17-13-24(14-18-30-16-12-23)32(27,28)22-9-5-20(2)6-10-22/h3-10H,11-18H2,1-2H3 |
| InChIKey | STSDBOPQLKGDLP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |