C29H42N2O8S2 — CID 155638344
(1R,18R)-5,14-bis-(4-methylphenyl)sulfonyl-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.3.0]henicosane (PubChem CID 155638344) has the molecular formula C29H42N2O8S2 and a molecular weight of 610.80 g/mol. Its IUPAC name is (1R,18R)-5,14-bis-(4-methylphenyl)sulfonyl-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.3.0]henicosane.
| Compound Name | (1R,18R)-5,14-bis-(4-methylphenyl)sulfonyl-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.3.0]henicosane |
|---|---|
| PubChem CID | 155638344 |
| Molecular Formula | C29H42N2O8S2 |
| Molecular Weight | 610.80 g/mol |
| Exact Mass | 610.24 |
| IUPAC Name | (1R,18R)-5,14-bis-(4-methylphenyl)sulfonyl-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.3.0]henicosane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCCOCCN(S(=O)(=O)c3ccc(C)cc3)CCO[C@@H]3CCC[C@H]3OCC2)cc1 |
| InChI | InChI=1S/C29H42N2O8S2/c1-24-6-10-26(11-7-24)40(32,33)30-14-18-36-22-23-37-19-15-31(41(34,35)27-12-8-25(2)9-13-27)17-21-39-29-5-3-4-28(29)38-20-16-30/h6-13,28-29H,3-5,14-23H2,1-2H3/t28-,29-/m1/s1 |
| InChIKey | YYLZCDJIKHONMR-FQLXRVMXSA-N |
| XLogP | 2.99 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.80 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |