C24H32N2O5S2 — CID 101249935
(7aR,11aR)-1,7-bis-(4-methylphenyl)sulfonyl-2,3,5,6,7a,8,9,10,11,11a-decahydrobenzo[e][1,4,7]oxadiazonine (PubChem CID 101249935) has the molecular formula C24H32N2O5S2 and a molecular weight of 492.66 g/mol. Its IUPAC name is (7aR,11aR)-1,7-bis-(4-methylphenyl)sulfonyl-2,3,5,6,7a,8,9,10,11,11a-decahydrobenzo[e][1,4,7]oxadiazonine.
| Compound Name | (7aR,11aR)-1,7-bis-(4-methylphenyl)sulfonyl-2,3,5,6,7a,8,9,10,11,11a-decahydrobenzo[e][1,4,7]oxadiazonine |
|---|---|
| PubChem CID | 101249935 |
| Molecular Formula | C24H32N2O5S2 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | (7aR,11aR)-1,7-bis-(4-methylphenyl)sulfonyl-2,3,5,6,7a,8,9,10,11,11a-decahydrobenzo[e][1,4,7]oxadiazonine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCCN(S(=O)(=O)c3ccc(C)cc3)[C@@H]3CCCC[C@H]32)cc1 |
| InChI | InChI=1S/C24H32N2O5S2/c1-19-7-11-21(12-8-19)32(27,28)25-15-17-31-18-16-26(24-6-4-3-5-23(24)25)33(29,30)22-13-9-20(2)10-14-22/h7-14,23-24H,3-6,15-18H2,1-2H3/t23-,24-/m1/s1 |
| InChIKey | IZWKXJXKAFPFBW-DNQXCXABSA-N |
| XLogP | 3.33 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |