C16H23NO5S2 — CID 127756095
1-(4-methylsulfonylphenyl)sulfonyl-2-(oxan-4-yl)pyrrolidine (PubChem CID 127756095) has the molecular formula C16H23NO5S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 1-(4-methylsulfonylphenyl)sulfonyl-2-(oxan-4-yl)pyrrolidine.
| Compound Name | 1-(4-methylsulfonylphenyl)sulfonyl-2-(oxan-4-yl)pyrrolidine |
|---|---|
| PubChem CID | 127756095 |
| Molecular Formula | C16H23NO5S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 1-(4-methylsulfonylphenyl)sulfonyl-2-(oxan-4-yl)pyrrolidine |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)N2CCCC2C2CCOCC2)cc1 |
| InChI | InChI=1S/C16H23NO5S2/c1-23(18,19)14-4-6-15(7-5-14)24(20,21)17-10-2-3-16(17)13-8-11-22-12-9-13/h4-7,13,16H,2-3,8-12H2,1H3 |
| InChIKey | OLGKKOBPIWHXAT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |