C12H19ClN2O4S2 — CID 119988752
[1-(4-methylsulfonylphenyl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride (PubChem CID 119988752) has the molecular formula C12H19ClN2O4S2 and a molecular weight of 354.88 g/mol. Its IUPAC name is [1-(4-methylsulfonylphenyl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride.
| Compound Name | [1-(4-methylsulfonylphenyl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119988752 |
| Molecular Formula | C12H19ClN2O4S2 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | [1-(4-methylsulfonylphenyl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)N2CCCC2CN)cc1.Cl |
| InChI | InChI=1S/C12H18N2O4S2.ClH/c1-19(15,16)11-4-6-12(7-5-11)20(17,18)14-8-2-3-10(14)9-13;/h4-7,10H,2-3,8-9,13H2,1H3;1H |
| InChIKey | VEOCEANYOOZXMR-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |