C13H21ClN2O4S2 — CID 119969590
[1-(3-methylsulfonylphenyl)sulfonylpiperidin-2-yl]methanamine;hydrochloride (PubChem CID 119969590) has the molecular formula C13H21ClN2O4S2 and a molecular weight of 368.91 g/mol. Its IUPAC name is [1-(3-methylsulfonylphenyl)sulfonylpiperidin-2-yl]methanamine;hydrochloride.
| Compound Name | [1-(3-methylsulfonylphenyl)sulfonylpiperidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119969590 |
| Molecular Formula | C13H21ClN2O4S2 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | [1-(3-methylsulfonylphenyl)sulfonylpiperidin-2-yl]methanamine;hydrochloride |
| SMILES | CS(=O)(=O)c1cccc(S(=O)(=O)N2CCCCC2CN)c1.Cl |
| InChI | InChI=1S/C13H20N2O4S2.ClH/c1-20(16,17)12-6-4-7-13(9-12)21(18,19)15-8-3-2-5-11(15)10-14;/h4,6-7,9,11H,2-3,5,8,10,14H2,1H3;1H |
| InChIKey | YIHONUOSMBWVIQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |