C15H20ClN3O4S — CID 119969518
5-[2-(aminomethyl)piperidin-1-yl]sulfonyl-2-methylisoindole-1,3-dione;hydrochloride (PubChem CID 119969518) has the molecular formula C15H20ClN3O4S and a molecular weight of 373.86 g/mol. Its IUPAC name is 5-[2-(aminomethyl)piperidin-1-yl]sulfonyl-2-methylisoindole-1,3-dione;hydrochloride.
| Compound Name | 5-[2-(aminomethyl)piperidin-1-yl]sulfonyl-2-methylisoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 119969518 |
| Molecular Formula | C15H20ClN3O4S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 5-[2-(aminomethyl)piperidin-1-yl]sulfonyl-2-methylisoindole-1,3-dione;hydrochloride |
| SMILES | CN1C(=O)c2ccc(S(=O)(=O)N3CCCCC3CN)cc2C1=O.Cl |
| InChI | InChI=1S/C15H19N3O4S.ClH/c1-17-14(19)12-6-5-11(8-13(12)15(17)20)23(21,22)18-7-3-2-4-10(18)9-16;/h5-6,8,10H,2-4,7,9,16H2,1H3;1H |
| InChIKey | VHHVGDGVTNQVAV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|