C15H18N2O4S — CID 100820359
5-[(2R)-2-ethylpiperidin-1-yl]sulfonylisoindole-1,3-dione (PubChem CID 100820359) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is 5-[(2R)-2-ethylpiperidin-1-yl]sulfonylisoindole-1,3-dione.
| Compound Name | 5-[(2R)-2-ethylpiperidin-1-yl]sulfonylisoindole-1,3-dione |
|---|---|
| PubChem CID | 100820359 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 5-[(2R)-2-ethylpiperidin-1-yl]sulfonylisoindole-1,3-dione |
| SMILES | CC[C@@H]1CCCCN1S(=O)(=O)c1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C15H18N2O4S/c1-2-10-5-3-4-8-17(10)22(20,21)11-6-7-12-13(9-11)15(19)16-14(12)18/h6-7,9-10H,2-5,8H2,1H3,(H,16,18,19)/t10-/m1/s1 |
| InChIKey | XMNXMXSOWKTVHA-SNVBAGLBSA-N |
| XLogP | 1.52 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|