C13H18ClNO4S2 — CID 43266562
3-(2-ethylpiperidin-1-yl)sulfonylbenzenesulfonyl chloride (PubChem CID 43266562) has the molecular formula C13H18ClNO4S2 and a molecular weight of 351.88 g/mol. Its IUPAC name is 3-(2-ethylpiperidin-1-yl)sulfonylbenzenesulfonyl chloride.
| Compound Name | 3-(2-ethylpiperidin-1-yl)sulfonylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 43266562 |
| Molecular Formula | C13H18ClNO4S2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 3-(2-ethylpiperidin-1-yl)sulfonylbenzenesulfonyl chloride |
| SMILES | CCC1CCCCN1S(=O)(=O)c1cccc(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C13H18ClNO4S2/c1-2-11-6-3-4-9-15(11)21(18,19)13-8-5-7-12(10-13)20(14,16)17/h5,7-8,10-11H,2-4,6,9H2,1H3 |
| InChIKey | GXVPOUIAYIWLNE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |