C13H18BrNO2S — CID 80676500
2-(bromomethyl)-1-(3-methylphenyl)sulfonylpiperidine (PubChem CID 80676500) has the molecular formula C13H18BrNO2S and a molecular weight of 332.26 g/mol. Its IUPAC name is 2-(bromomethyl)-1-(3-methylphenyl)sulfonylpiperidine.
| Compound Name | 2-(bromomethyl)-1-(3-methylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 80676500 |
| Molecular Formula | C13H18BrNO2S |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 2-(bromomethyl)-1-(3-methylphenyl)sulfonylpiperidine |
| SMILES | Cc1cccc(S(=O)(=O)N2CCCCC2CBr)c1 |
| InChI | InChI=1S/C13H18BrNO2S/c1-11-5-4-7-13(9-11)18(16,17)15-8-3-2-6-12(15)10-14/h4-5,7,9,12H,2-3,6,8,10H2,1H3 |
| InChIKey | YLNQGKAJZXRPGF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|