C21H31F3N2O2S — CID 123679283
1-(3-methylphenyl)sulfonyl-2-[3-[4-(trifluoromethyl)piperidin-1-yl]propyl]piperidine (PubChem CID 123679283) has the molecular formula C21H31F3N2O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is 1-(3-methylphenyl)sulfonyl-2-[3-[4-(trifluoromethyl)piperidin-1-yl]propyl]piperidine.
| Compound Name | 1-(3-methylphenyl)sulfonyl-2-[3-[4-(trifluoromethyl)piperidin-1-yl]propyl]piperidine |
|---|---|
| PubChem CID | 123679283 |
| Molecular Formula | C21H31F3N2O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 1-(3-methylphenyl)sulfonyl-2-[3-[4-(trifluoromethyl)piperidin-1-yl]propyl]piperidine |
| SMILES | Cc1cccc(S(=O)(=O)N2CCCCC2CCCN2CCC(C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C21H31F3N2O2S/c1-17-6-4-9-20(16-17)29(27,28)26-13-3-2-7-19(26)8-5-12-25-14-10-18(11-15-25)21(22,23)24/h4,6,9,16,18-19H,2-3,5,7-8,10-15H2,1H3 |
| InChIKey | LLKWSGKDGKHEEQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |