C14H17N3O4S — CID 119988962
5-[2-(aminomethyl)pyrrolidin-1-yl]sulfonyl-2-methylisoindole-1,3-dione (PubChem CID 119988962) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is 5-[2-(aminomethyl)pyrrolidin-1-yl]sulfonyl-2-methylisoindole-1,3-dione.
| Compound Name | 5-[2-(aminomethyl)pyrrolidin-1-yl]sulfonyl-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 119988962 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 5-[2-(aminomethyl)pyrrolidin-1-yl]sulfonyl-2-methylisoindole-1,3-dione |
| SMILES | CN1C(=O)c2ccc(S(=O)(=O)N3CCCC3CN)cc2C1=O |
| InChI | InChI=1S/C14H17N3O4S/c1-16-13(18)11-5-4-10(7-12(11)14(16)19)22(20,21)17-6-2-3-9(17)8-15/h4-5,7,9H,2-3,6,8,15H2,1H3 |
| InChIKey | BKLIORYPRFTRHG-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|