C14H22N2O2S — CID 97325791
[(2S)-1-(3-propan-2-ylphenyl)sulfonylpyrrolidin-2-yl]methanamine (PubChem CID 97325791) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is [(2S)-1-(3-propan-2-ylphenyl)sulfonylpyrrolidin-2-yl]methanamine.
| Compound Name | [(2S)-1-(3-propan-2-ylphenyl)sulfonylpyrrolidin-2-yl]methanamine |
|---|---|
| PubChem CID | 97325791 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | [(2S)-1-(3-propan-2-ylphenyl)sulfonylpyrrolidin-2-yl]methanamine |
| SMILES | CC(C)c1cccc(S(=O)(=O)N2CCC[C@H]2CN)c1 |
| InChI | InChI=1S/C14H22N2O2S/c1-11(2)12-5-3-7-14(9-12)19(17,18)16-8-4-6-13(16)10-15/h3,5,7,9,11,13H,4,6,8,10,15H2,1-2H3/t13-/m0/s1 |
| InChIKey | SOQCXHFZWMXDTO-ZDUSSCGKSA-N |
| XLogP | 1.92 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |