C15H21NO6S2 — CID 55559347
ethyl 1-(3-methylsulfonylphenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 55559347) has the molecular formula C15H21NO6S2 and a molecular weight of 375.47 g/mol. Its IUPAC name is ethyl 1-(3-methylsulfonylphenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | ethyl 1-(3-methylsulfonylphenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 55559347 |
| Molecular Formula | C15H21NO6S2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | ethyl 1-(3-methylsulfonylphenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1S(=O)(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H21NO6S2/c1-3-22-15(17)14-9-4-5-10-16(14)24(20,21)13-8-6-7-12(11-13)23(2,18)19/h6-8,11,14H,3-5,9-10H2,1-2H3 |
| InChIKey | ZEWHHWXQNBBWJK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |