C16H21ClN2O5S — CID 3673261
ethyl 1-(4-acetamido-3-chlorophenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 3673261) has the molecular formula C16H21ClN2O5S and a molecular weight of 388.87 g/mol. Its IUPAC name is ethyl 1-(4-acetamido-3-chlorophenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | ethyl 1-(4-acetamido-3-chlorophenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 3673261 |
| Molecular Formula | C16H21ClN2O5S |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | ethyl 1-(4-acetamido-3-chlorophenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1S(=O)(=O)c1ccc(NC(C)=O)c(Cl)c1 |
| InChI | InChI=1S/C16H21ClN2O5S/c1-3-24-16(21)15-6-4-5-9-19(15)25(22,23)12-7-8-14(13(17)10-12)18-11(2)20/h7-8,10,15H,3-6,9H2,1-2H3,(H,18,20) |
| InChIKey | ROKNKAZAMXFUKK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |