C19H20BrClN2O3S — CID 92887775
(2S)-1-(4-bromophenyl)sulfonyl-N-(2-chloro-4-methylphenyl)piperidine-2-carboxamide (PubChem CID 92887775) has the molecular formula C19H20BrClN2O3S and a molecular weight of 471.80 g/mol. Its IUPAC name is (2S)-1-(4-bromophenyl)sulfonyl-N-(2-chloro-4-methylphenyl)piperidine-2-carboxamide.
| Compound Name | (2S)-1-(4-bromophenyl)sulfonyl-N-(2-chloro-4-methylphenyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 92887775 |
| Molecular Formula | C19H20BrClN2O3S |
| Molecular Weight | 471.80 g/mol |
| Exact Mass | 470.01 |
| IUPAC Name | (2S)-1-(4-bromophenyl)sulfonyl-N-(2-chloro-4-methylphenyl)piperidine-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@@H]2CCCCN2S(=O)(=O)c2ccc(Br)cc2)c(Cl)c1 |
| InChI | InChI=1S/C19H20BrClN2O3S/c1-13-5-10-17(16(21)12-13)22-19(24)18-4-2-3-11-23(18)27(25,26)15-8-6-14(20)7-9-15/h5-10,12,18H,2-4,11H2,1H3,(H,22,24)/t18-/m0/s1 |
| InChIKey | DXPVSMZLZYIJJF-SFHVURJKSA-N |
| XLogP | 4.59 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.80 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |