C19H21BrN2O3S — CID 24617125
1-(4-bromophenyl)sulfonyl-N-(3,5-dimethylphenyl)pyrrolidine-2-carboxamide (PubChem CID 24617125) has the molecular formula C19H21BrN2O3S and a molecular weight of 437.36 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-N-(3,5-dimethylphenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(4-bromophenyl)sulfonyl-N-(3,5-dimethylphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 24617125 |
| Molecular Formula | C19H21BrN2O3S |
| Molecular Weight | 437.36 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-N-(3,5-dimethylphenyl)pyrrolidine-2-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)C2CCCN2S(=O)(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C19H21BrN2O3S/c1-13-10-14(2)12-16(11-13)21-19(23)18-4-3-9-22(18)26(24,25)17-7-5-15(20)6-8-17/h5-8,10-12,18H,3-4,9H2,1-2H3,(H,21,23) |
| InChIKey | LIQMNTMPOCEMEL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |