C14H16BrCl2NO4S — CID 47006019
ethyl 1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 47006019) has the molecular formula C14H16BrCl2NO4S and a molecular weight of 445.16 g/mol. Its IUPAC name is ethyl 1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | ethyl 1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 47006019 |
| Molecular Formula | C14H16BrCl2NO4S |
| Molecular Weight | 445.16 g/mol |
| Exact Mass | 442.94 |
| IUPAC Name | ethyl 1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1S(=O)(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C14H16BrCl2NO4S/c1-2-22-14(19)12-5-3-4-6-18(12)23(20,21)13-10(16)7-9(15)8-11(13)17/h7-8,12H,2-6H2,1H3 |
| InChIKey | WCOKMAPTKMYUEL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.16 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |