C12H12BrCl2NO4S — CID 43084154
1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperidine-2-carboxylic acid (PubChem CID 43084154) has the molecular formula C12H12BrCl2NO4S and a molecular weight of 417.11 g/mol. Its IUPAC name is 1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperidine-2-carboxylic acid.
| Compound Name | 1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 43084154 |
| Molecular Formula | C12H12BrCl2NO4S |
| Molecular Weight | 417.11 g/mol |
| Exact Mass | 414.90 |
| IUPAC Name | 1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1S(=O)(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C12H12BrCl2NO4S/c13-7-5-8(14)11(9(15)6-7)21(19,20)16-4-2-1-3-10(16)12(17)18/h5-6,10H,1-4H2,(H,17,18) |
| InChIKey | SHPGQFCXLVDKIG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.11 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |