C12H12F3NO4S — CID 60971816
1-(2,4,6-trifluorophenyl)sulfonylpiperidine-2-carboxylic acid (PubChem CID 60971816) has the molecular formula C12H12F3NO4S and a molecular weight of 323.29 g/mol. Its IUPAC name is 1-(2,4,6-trifluorophenyl)sulfonylpiperidine-2-carboxylic acid.
| Compound Name | 1-(2,4,6-trifluorophenyl)sulfonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 60971816 |
| Molecular Formula | C12H12F3NO4S |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 1-(2,4,6-trifluorophenyl)sulfonylpiperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1S(=O)(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C12H12F3NO4S/c13-7-5-8(14)11(9(15)6-7)21(19,20)16-4-2-1-3-10(16)12(17)18/h5-6,10H,1-4H2,(H,17,18) |
| InChIKey | PTEUYLLMRCRUIT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |