C13H14F3NO3S — CID 79539023
1-[1-(2,4,6-trifluorophenyl)sulfonylpyrrolidin-2-yl]propan-2-one (PubChem CID 79539023) has the molecular formula C13H14F3NO3S and a molecular weight of 321.32 g/mol. Its IUPAC name is 1-[1-(2,4,6-trifluorophenyl)sulfonylpyrrolidin-2-yl]propan-2-one.
| Compound Name | 1-[1-(2,4,6-trifluorophenyl)sulfonylpyrrolidin-2-yl]propan-2-one |
|---|---|
| PubChem CID | 79539023 |
| Molecular Formula | C13H14F3NO3S |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 1-[1-(2,4,6-trifluorophenyl)sulfonylpyrrolidin-2-yl]propan-2-one |
| SMILES | CC(=O)CC1CCCN1S(=O)(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C13H14F3NO3S/c1-8(18)5-10-3-2-4-17(10)21(19,20)13-11(15)6-9(14)7-12(13)16/h6-7,10H,2-5H2,1H3 |
| InChIKey | QXRLPLMNBZUMQH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |