C13H15ClFNO3S — CID 105400230
1-[1-(2-chloro-5-fluorophenyl)sulfonylpyrrolidin-2-yl]propan-2-one (PubChem CID 105400230) has the molecular formula C13H15ClFNO3S and a molecular weight of 319.79 g/mol. Its IUPAC name is 1-[1-(2-chloro-5-fluorophenyl)sulfonylpyrrolidin-2-yl]propan-2-one.
| Compound Name | 1-[1-(2-chloro-5-fluorophenyl)sulfonylpyrrolidin-2-yl]propan-2-one |
|---|---|
| PubChem CID | 105400230 |
| Molecular Formula | C13H15ClFNO3S |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 1-[1-(2-chloro-5-fluorophenyl)sulfonylpyrrolidin-2-yl]propan-2-one |
| SMILES | CC(=O)CC1CCCN1S(=O)(=O)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C13H15ClFNO3S/c1-9(17)7-11-3-2-6-16(11)20(18,19)13-8-10(15)4-5-12(13)14/h4-5,8,11H,2-3,6-7H2,1H3 |
| InChIKey | YBSGGXGACOQLEQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |