C13H16ClFN2O3S — CID 95632899
2-[(2S)-1-(2-chloro-5-fluorophenyl)sulfonylpiperidin-2-yl]acetamide (PubChem CID 95632899) has the molecular formula C13H16ClFN2O3S and a molecular weight of 334.80 g/mol. Its IUPAC name is 2-[(2S)-1-(2-chloro-5-fluorophenyl)sulfonylpiperidin-2-yl]acetamide.
| Compound Name | 2-[(2S)-1-(2-chloro-5-fluorophenyl)sulfonylpiperidin-2-yl]acetamide |
|---|---|
| PubChem CID | 95632899 |
| Molecular Formula | C13H16ClFN2O3S |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 2-[(2S)-1-(2-chloro-5-fluorophenyl)sulfonylpiperidin-2-yl]acetamide |
| SMILES | NC(=O)C[C@@H]1CCCCN1S(=O)(=O)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C13H16ClFN2O3S/c14-11-5-4-9(15)7-12(11)21(19,20)17-6-2-1-3-10(17)8-13(16)18/h4-5,7,10H,1-3,6,8H2,(H2,16,18)/t10-/m0/s1 |
| InChIKey | ALWKJWJWOBXABJ-JTQLQIEISA-N |
| XLogP | 1.90 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |