C11H10Cl3NO4S — CID 43361188
1-(2,4,6-trichlorophenyl)sulfonylpyrrolidine-2-carboxylic acid (PubChem CID 43361188) has the molecular formula C11H10Cl3NO4S and a molecular weight of 358.63 g/mol. Its IUPAC name is 1-(2,4,6-trichlorophenyl)sulfonylpyrrolidine-2-carboxylic acid.
| Compound Name | 1-(2,4,6-trichlorophenyl)sulfonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 43361188 |
| Molecular Formula | C11H10Cl3NO4S |
| Molecular Weight | 358.63 g/mol |
| Exact Mass | 356.94 |
| IUPAC Name | 1-(2,4,6-trichlorophenyl)sulfonylpyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1S(=O)(=O)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H10Cl3NO4S/c12-6-4-7(13)10(8(14)5-6)20(18,19)15-3-1-2-9(15)11(16)17/h4-5,9H,1-3H2,(H,16,17) |
| InChIKey | YJVVIEXBURNIAI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.63 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |