C18H27NO4S — CID 52505893
ethyl (2R)-1-(4-tert-butylphenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 52505893) has the molecular formula C18H27NO4S and a molecular weight of 353.48 g/mol. Its IUPAC name is ethyl (2R)-1-(4-tert-butylphenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | ethyl (2R)-1-(4-tert-butylphenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 52505893 |
| Molecular Formula | C18H27NO4S |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | ethyl (2R)-1-(4-tert-butylphenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCCN1S(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H27NO4S/c1-5-23-17(20)16-8-6-7-13-19(16)24(21,22)15-11-9-14(10-12-15)18(2,3)4/h9-12,16H,5-8,13H2,1-4H3/t16-/m1/s1 |
| InChIKey | DYGMTXDCHOHZLW-MRXNPFEDSA-N |
| XLogP | 3.09 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |