C14H16F3NO4S — CID 47006020
ethyl 1-(2,3,4-trifluorophenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 47006020) has the molecular formula C14H16F3NO4S and a molecular weight of 351.35 g/mol. Its IUPAC name is ethyl 1-(2,3,4-trifluorophenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | ethyl 1-(2,3,4-trifluorophenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 47006020 |
| Molecular Formula | C14H16F3NO4S |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | ethyl 1-(2,3,4-trifluorophenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1S(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H16F3NO4S/c1-2-22-14(19)10-5-3-4-8-18(10)23(20,21)11-7-6-9(15)12(16)13(11)17/h6-7,10H,2-5,8H2,1H3 |
| InChIKey | XZRKHJCWWIEJEY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|