C17H25NO4S — CID 4737355
ethyl 1-(2,4,6-trimethylphenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 4737355) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is ethyl 1-(2,4,6-trimethylphenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | ethyl 1-(2,4,6-trimethylphenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 4737355 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | ethyl 1-(2,4,6-trimethylphenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1S(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C17H25NO4S/c1-5-22-17(19)15-8-6-7-9-18(15)23(20,21)16-13(3)10-12(2)11-14(16)4/h10-11,15H,5-9H2,1-4H3 |
| InChIKey | SSAFESRACALMFW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |