C13H17F3N2O2S — CID 63255176
1-[1-(2,3,4-trifluorophenyl)sulfonylpiperidin-2-yl]ethanamine (PubChem CID 63255176) has the molecular formula C13H17F3N2O2S and a molecular weight of 322.35 g/mol. Its IUPAC name is 1-[1-(2,3,4-trifluorophenyl)sulfonylpiperidin-2-yl]ethanamine.
| Compound Name | 1-[1-(2,3,4-trifluorophenyl)sulfonylpiperidin-2-yl]ethanamine |
|---|---|
| PubChem CID | 63255176 |
| Molecular Formula | C13H17F3N2O2S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 1-[1-(2,3,4-trifluorophenyl)sulfonylpiperidin-2-yl]ethanamine |
| SMILES | CC(N)C1CCCCN1S(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H17F3N2O2S/c1-8(17)10-4-2-3-7-18(10)21(19,20)11-6-5-9(14)12(15)13(11)16/h5-6,8,10H,2-4,7,17H2,1H3 |
| InChIKey | XZFBRKNVQAZSPF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|