C15H22N2O3S — CID 2392292
(2R)-1-(4-tert-butylphenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 2392292) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is (2R)-1-(4-tert-butylphenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-(4-tert-butylphenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 2392292 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (2R)-1-(4-tert-butylphenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCC[C@@H]2C(N)=O)cc1 |
| InChI | InChI=1S/C15H22N2O3S/c1-15(2,3)11-6-8-12(9-7-11)21(19,20)17-10-4-5-13(17)14(16)18/h6-9,13H,4-5,10H2,1-3H3,(H2,16,18)/t13-/m1/s1 |
| InChIKey | JXVSPFVRAXMZMW-CYBMUJFWSA-N |
| XLogP | 1.62 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |