C15H21NO6S2 — CID 52847388
(2R)-2-(1,3-dioxolan-2-yl)-1-(4-methylsulfonylphenyl)sulfonylpiperidine (PubChem CID 52847388) has the molecular formula C15H21NO6S2 and a molecular weight of 375.47 g/mol. Its IUPAC name is (2R)-2-(1,3-dioxolan-2-yl)-1-(4-methylsulfonylphenyl)sulfonylpiperidine.
| Compound Name | (2R)-2-(1,3-dioxolan-2-yl)-1-(4-methylsulfonylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 52847388 |
| Molecular Formula | C15H21NO6S2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | (2R)-2-(1,3-dioxolan-2-yl)-1-(4-methylsulfonylphenyl)sulfonylpiperidine |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)N2CCCC[C@@H]2C2OCCO2)cc1 |
| InChI | InChI=1S/C15H21NO6S2/c1-23(17,18)12-5-7-13(8-6-12)24(19,20)16-9-3-2-4-14(16)15-21-10-11-22-15/h5-8,14-15H,2-4,9-11H2,1H3/t14-/m1/s1 |
| InChIKey | OAGHOMKMPDOSQJ-CQSZACIVSA-N |
| XLogP | 1.01 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |