C14H18N2O6S — CID 52847334
(2S)-2-(1,3-dioxolan-2-yl)-1-(2-nitrophenyl)sulfonylpiperidine (PubChem CID 52847334) has the molecular formula C14H18N2O6S and a molecular weight of 342.37 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxolan-2-yl)-1-(2-nitrophenyl)sulfonylpiperidine.
| Compound Name | (2S)-2-(1,3-dioxolan-2-yl)-1-(2-nitrophenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 52847334 |
| Molecular Formula | C14H18N2O6S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | (2S)-2-(1,3-dioxolan-2-yl)-1-(2-nitrophenyl)sulfonylpiperidine |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)N1CCCC[C@H]1C1OCCO1 |
| InChI | InChI=1S/C14H18N2O6S/c17-16(18)11-5-1-2-7-13(11)23(19,20)15-8-4-3-6-12(15)14-21-9-10-22-14/h1-2,5,7,12,14H,3-4,6,8-10H2/t12-/m0/s1 |
| InChIKey | BSVBMRJEBFXLIX-LBPRGKRZSA-N |
| XLogP | 1.51 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|