C19H22N2O4S — CID 95079015
(2R)-2-(3-methylphenyl)-1-(2-nitrophenyl)sulfonylazepane (PubChem CID 95079015) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is (2R)-2-(3-methylphenyl)-1-(2-nitrophenyl)sulfonylazepane.
| Compound Name | (2R)-2-(3-methylphenyl)-1-(2-nitrophenyl)sulfonylazepane |
|---|---|
| PubChem CID | 95079015 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | (2R)-2-(3-methylphenyl)-1-(2-nitrophenyl)sulfonylazepane |
| SMILES | Cc1cccc([C@H]2CCCCCN2S(=O)(=O)c2ccccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H22N2O4S/c1-15-8-7-9-16(14-15)17-10-3-2-6-13-20(17)26(24,25)19-12-5-4-11-18(19)21(22)23/h4-5,7-9,11-12,14,17H,2-3,6,10,13H2,1H3/t17-/m1/s1 |
| InChIKey | DIGZGYRPWPKEEW-QGZVFWFLSA-N |
| XLogP | 4.21 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|