C16H25NO2S — CID 95078889
(2S)-2-(3-methylphenyl)-1-propylsulfonylazepane (PubChem CID 95078889) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is (2S)-2-(3-methylphenyl)-1-propylsulfonylazepane.
| Compound Name | (2S)-2-(3-methylphenyl)-1-propylsulfonylazepane |
|---|---|
| PubChem CID | 95078889 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (2S)-2-(3-methylphenyl)-1-propylsulfonylazepane |
| SMILES | CCCS(=O)(=O)N1CCCCC[C@H]1c1cccc(C)c1 |
| InChI | InChI=1S/C16H25NO2S/c1-3-12-20(18,19)17-11-6-4-5-10-16(17)15-9-7-8-14(2)13-15/h7-9,13,16H,3-6,10-12H2,1-2H3/t16-/m0/s1 |
| InChIKey | UHUGFDVXGNFCJC-INIZCTEOSA-N |
| XLogP | 3.65 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |