C22H33N3O3S — CID 3324124
3-(3-methylphenyl)-5-(1-octylsulfonylpiperidin-2-yl)-1,2,4-oxadiazole (PubChem CID 3324124) has the molecular formula C22H33N3O3S and a molecular weight of 419.59 g/mol. Its IUPAC name is 3-(3-methylphenyl)-5-(1-octylsulfonylpiperidin-2-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(3-methylphenyl)-5-(1-octylsulfonylpiperidin-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 3324124 |
| Molecular Formula | C22H33N3O3S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 3-(3-methylphenyl)-5-(1-octylsulfonylpiperidin-2-yl)-1,2,4-oxadiazole |
| SMILES | CCCCCCCCS(=O)(=O)N1CCCCC1c1nc(-c2cccc(C)c2)no1 |
| InChI | InChI=1S/C22H33N3O3S/c1-3-4-5-6-7-10-16-29(26,27)25-15-9-8-14-20(25)22-23-21(24-28-22)19-13-11-12-18(2)17-19/h11-13,17,20H,3-10,14-16H2,1-2H3 |
| InChIKey | IQHIGZJZIZAIKG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|