C20H27N3O2 — CID 42760280
1-[3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]hexan-1-one (PubChem CID 42760280) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 1-[3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]hexan-1-one.
| Compound Name | 1-[3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 42760280 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 1-[3-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCCC(c2nc(-c3cccc(C)c3)no2)C1 |
| InChI | InChI=1S/C20H27N3O2/c1-3-4-5-11-18(24)23-12-7-10-17(14-23)20-21-19(22-25-20)16-9-6-8-15(2)13-16/h6,8-9,13,17H,3-5,7,10-12,14H2,1-2H3 |
| InChIKey | IYUBNKUDHFGGNT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|