C20H27N3O2 — CID 7351261
1-[(3S)-3-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]heptan-1-one (PubChem CID 7351261) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 1-[(3S)-3-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]heptan-1-one.
| Compound Name | 1-[(3S)-3-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]heptan-1-one |
|---|---|
| PubChem CID | 7351261 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 1-[(3S)-3-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]heptan-1-one |
| SMILES | CCCCCCC(=O)N1CCC[C@H](c2nc(-c3ccccc3)no2)C1 |
| InChI | InChI=1S/C20H27N3O2/c1-2-3-4-8-13-18(24)23-14-9-12-17(15-23)20-21-19(22-25-20)16-10-6-5-7-11-16/h5-7,10-11,17H,2-4,8-9,12-15H2,1H3/t17-/m0/s1 |
| InChIKey | MJSYJKYEQIBBML-KRWDZBQOSA-N |
| XLogP | 4.41 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|