C23H33N3O3 — CID 3941712
1-[4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]nonan-1-one (PubChem CID 3941712) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is 1-[4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]nonan-1-one.
| Compound Name | 1-[4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]nonan-1-one |
|---|---|
| PubChem CID | 3941712 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | 1-[4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]nonan-1-one |
| SMILES | CCCCCCCCC(=O)N1CCC(c2nc(-c3ccc(OC)cc3)no2)CC1 |
| InChI | InChI=1S/C23H33N3O3/c1-3-4-5-6-7-8-9-21(27)26-16-14-19(15-17-26)23-24-22(25-29-23)18-10-12-20(28-2)13-11-18/h10-13,19H,3-9,14-17H2,1-2H3 |
| InChIKey | YTSGMCQRQFMFKK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|