C24H35N3O3 — CID 3309254
1-[4-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]decan-1-one (PubChem CID 3309254) has the molecular formula C24H35N3O3 and a molecular weight of 413.56 g/mol. Its IUPAC name is 1-[4-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]decan-1-one.
| Compound Name | 1-[4-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]decan-1-one |
|---|---|
| PubChem CID | 3309254 |
| Molecular Formula | C24H35N3O3 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | 1-[4-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]decan-1-one |
| SMILES | CCCCCCCCCC(=O)N1CCC(c2nc(-c3cccc(OC)c3)no2)CC1 |
| InChI | InChI=1S/C24H35N3O3/c1-3-4-5-6-7-8-9-13-22(28)27-16-14-19(15-17-27)24-25-23(26-30-24)20-11-10-12-21(18-20)29-2/h10-12,18-19H,3-9,13-17H2,1-2H3 |
| InChIKey | NCDJMCMSHPPGER-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|