C19H24ClN3O2 — CID 5149726
1-[4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]hexan-1-one (PubChem CID 5149726) has the molecular formula C19H24ClN3O2 and a molecular weight of 361.87 g/mol. Its IUPAC name is 1-[4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]hexan-1-one.
| Compound Name | 1-[4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 5149726 |
| Molecular Formula | C19H24ClN3O2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 1-[4-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCC(c2nc(-c3ccc(Cl)cc3)no2)CC1 |
| InChI | InChI=1S/C19H24ClN3O2/c1-2-3-4-5-17(24)23-12-10-15(11-13-23)19-21-18(22-25-19)14-6-8-16(20)9-7-14/h6-9,15H,2-5,10-13H2,1H3 |
| InChIKey | GPENJDANSJSMPD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|