C21H28ClN3O2 — CID 3589573
1-[4-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]octan-1-one (PubChem CID 3589573) has the molecular formula C21H28ClN3O2 and a molecular weight of 389.93 g/mol. Its IUPAC name is 1-[4-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]octan-1-one.
| Compound Name | 1-[4-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]octan-1-one |
|---|---|
| PubChem CID | 3589573 |
| Molecular Formula | C21H28ClN3O2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 1-[4-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]octan-1-one |
| SMILES | CCCCCCCC(=O)N1CCC(c2nc(-c3cccc(Cl)c3)no2)CC1 |
| InChI | InChI=1S/C21H28ClN3O2/c1-2-3-4-5-6-10-19(26)25-13-11-16(12-14-25)21-23-20(24-27-21)17-8-7-9-18(22)15-17/h7-9,15-16H,2-6,10-14H2,1H3 |
| InChIKey | IECNDMDGNGYETM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|