C19H26ClN4O2+ — CID 7289117
[6-[(3S)-3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-6-oxohexyl]azanium (PubChem CID 7289117) has the molecular formula C19H26ClN4O2+ and a molecular weight of 377.90 g/mol. Its IUPAC name is [6-[(3S)-3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-6-oxohexyl]azanium.
| Compound Name | [6-[(3S)-3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-6-oxohexyl]azanium |
|---|---|
| PubChem CID | 7289117 |
| Molecular Formula | C19H26ClN4O2+ |
| Molecular Weight | 377.90 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | [6-[(3S)-3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-6-oxohexyl]azanium |
| SMILES | [NH3+]CCCCCC(=O)N1CCC[C@H](c2nc(-c3cccc(Cl)c3)no2)C1 |
| InChI | InChI=1S/C19H25ClN4O2/c20-16-8-4-6-14(12-16)18-22-19(26-23-18)15-7-5-11-24(13-15)17(25)9-2-1-3-10-21/h4,6,8,12,15H,1-3,5,7,9-11,13,21H2/p+1/t15-/m0/s1 |
| InChIKey | CJTYGAXODGMJEO-HNNXBMFYSA-O |
| XLogP | 2.90 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.90 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|