C20H26ClN3O2 — CID 4310348
1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]heptan-1-one (PubChem CID 4310348) has the molecular formula C20H26ClN3O2 and a molecular weight of 375.90 g/mol. Its IUPAC name is 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]heptan-1-one.
| Compound Name | 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]heptan-1-one |
|---|---|
| PubChem CID | 4310348 |
| Molecular Formula | C20H26ClN3O2 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]heptan-1-one |
| SMILES | CCCCCCC(=O)N1CCCCC1c1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C20H26ClN3O2/c1-2-3-4-5-9-18(25)24-14-7-6-8-17(24)20-22-19(23-26-20)15-10-12-16(21)13-11-15/h10-13,17H,2-9,14H2,1H3 |
| InChIKey | OEMAHVLEVBDHBT-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|