C31H39ClN4O3 — CID 98396509
N-benzyl-N-[2-[(2R)-2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]nonanamide (PubChem CID 98396509) has the molecular formula C31H39ClN4O3 and a molecular weight of 551.13 g/mol. Its IUPAC name is N-benzyl-N-[2-[(2R)-2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]nonanamide.
| Compound Name | N-benzyl-N-[2-[(2R)-2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]nonanamide |
|---|---|
| PubChem CID | 98396509 |
| Molecular Formula | C31H39ClN4O3 |
| Molecular Weight | 551.13 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | N-benzyl-N-[2-[(2R)-2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]nonanamide |
| SMILES | CCCCCCCCC(=O)N(CC(=O)N1CCCC[C@@H]1c1nc(-c2ccc(Cl)cc2)no1)Cc1ccccc1 |
| InChI | InChI=1S/C31H39ClN4O3/c1-2-3-4-5-6-10-16-28(37)35(22-24-13-8-7-9-14-24)23-29(38)36-21-12-11-15-27(36)31-33-30(34-39-31)25-17-19-26(32)20-18-25/h7-9,13-14,17-20,27H,2-6,10-12,15-16,21-23H2,1H3/t27-/m1/s1 |
| InChIKey | IERBDRWGHNNHAY-HHHXNRCGSA-N |
| XLogP | 7.22 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.13 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|