C26H37ClN4O3 — CID 4656396
N-[2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]-N-propan-2-yloctanamide (PubChem CID 4656396) has the molecular formula C26H37ClN4O3 and a molecular weight of 489.06 g/mol. Its IUPAC name is N-[2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]-N-propan-2-yloctanamide.
| Compound Name | N-[2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]-N-propan-2-yloctanamide |
|---|---|
| PubChem CID | 4656396 |
| Molecular Formula | C26H37ClN4O3 |
| Molecular Weight | 489.06 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | N-[2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]-N-propan-2-yloctanamide |
| SMILES | CCCCCCCC(=O)N(CC(=O)N1CCCCC1c1nc(-c2cccc(Cl)c2)no1)C(C)C |
| InChI | InChI=1S/C26H37ClN4O3/c1-4-5-6-7-8-15-23(32)31(19(2)3)18-24(33)30-16-10-9-14-22(30)26-28-25(29-34-26)20-12-11-13-21(27)17-20/h11-13,17,19,22H,4-10,14-16,18H2,1-3H3 |
| InChIKey | CFJXOVVRZAESHH-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.06 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|