C25H35ClN4O3 — CID 3353800
N-butyl-N-[2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]hexanamide (PubChem CID 3353800) has the molecular formula C25H35ClN4O3 and a molecular weight of 475.03 g/mol. Its IUPAC name is N-butyl-N-[2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]hexanamide.
| Compound Name | N-butyl-N-[2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]hexanamide |
|---|---|
| PubChem CID | 3353800 |
| Molecular Formula | C25H35ClN4O3 |
| Molecular Weight | 475.03 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | N-butyl-N-[2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]hexanamide |
| SMILES | CCCCCC(=O)N(CCCC)CC(=O)N1CCCCC1c1nc(-c2cccc(Cl)c2)no1 |
| InChI | InChI=1S/C25H35ClN4O3/c1-3-5-7-14-22(31)29(15-6-4-2)18-23(32)30-16-9-8-13-21(30)25-27-24(28-33-25)19-11-10-12-20(26)17-19/h10-12,17,21H,3-9,13-16,18H2,1-2H3 |
| InChIKey | VTSMSCRRRWXQOG-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.03 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|